Compound Q&A

What precautions should be taken when handling 1,5-Dichloro-2-nitro-4-(trifluoromethyl)benzene (CAS: 400-70-4)?

Answer

1,5-Dichloro-2-nitro-4-(trifluoromethyl)benzene
When handling 1,5-Dichloro-2-nitro-4-(trifluoromethyl)benzene, it is essential to wear appropriate personal protective equipment (PPE) including gloves, goggles, and a lab coat. This compound should be stored in a fume hood to minimize exposure to air and potential reactions. Spills should be cleaned up using absorbent materials, and the area should be ventilated. Always refer to the safety data sheet (SDS) for specific handling and disposal instructions.

About

CAS No 400-70-4
English Name 1,5-Dichloro-2-nitro-4-(trifluoromethyl)benzene
Molecular Formula C7H2Cl2F3NO2
Molecular Weight 259.99 g/mol
SMILES C1=C(C(=CC(=C1[N+](=O)[O-])Cl)Cl)C(F)(F)F
InChIKey VLVNHMVSVDVAOA-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,5-Dichloro-2-nitro-4-(trifluoromethyl)benzene (CAS: 400-70-4)?

1,5-Dichloro-2-nitro-4-(trifluoromethyl)benzene is a crystalline solid with a molecular weight of ap...

Compound Q&A

How is 1,5-Dichloro-2-nitro-4-(trifluoromethyl)benzene (CAS: 400-70-4) typically synthesized?

1,5-Dichloro-2-nitro-4-(trifluoromethyl)benzene is typically synthesized via the Friedel-Crafts alky...

Compound Q&A

What industries use 1,5-Dichloro-2-nitro-4-(trifluoromethyl)benzene (CAS: 400-70-4)?

1,5-Dichloro-2-nitro-4-(trifluoromethyl)benzene is used in the pharmaceutical industry for the synth...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...