Compound Q&A

What industries use 1,5-Dichloro-2-nitro-4-(trifluoromethyl)benzene (CAS: 400-70-4)?

Answer

1,5-Dichloro-2-nitro-4-(trifluoromethyl)benzene
1,5-Dichloro-2-nitro-4-(trifluoromethyl)benzene is used in the pharmaceutical industry for the synthesis of certain organic compounds. It is also utilized in the polymer industry for the production of advanced materials with specific properties. Additionally, it finds applications in the development of sensors and semiconductors due to its unique chemical structure.

About

CAS No 400-70-4
English Name 1,5-Dichloro-2-nitro-4-(trifluoromethyl)benzene
Molecular Formula C7H2Cl2F3NO2
Molecular Weight 259.99 g/mol
SMILES C1=C(C(=CC(=C1[N+](=O)[O-])Cl)Cl)C(F)(F)F
InChIKey VLVNHMVSVDVAOA-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,5-Dichloro-2-nitro-4-(trifluoromethyl)benzene (CAS: 400-70-4)?

1,5-Dichloro-2-nitro-4-(trifluoromethyl)benzene is a crystalline solid with a molecular weight of ap...

Compound Q&A

How is 1,5-Dichloro-2-nitro-4-(trifluoromethyl)benzene (CAS: 400-70-4) typically synthesized?

1,5-Dichloro-2-nitro-4-(trifluoromethyl)benzene is typically synthesized via the Friedel-Crafts alky...

Compound Q&A

What precautions should be taken when handling 1,5-Dichloro-2-nitro-4-(trifluoromethyl)benzene (CAS: 400-70-4)?

When handling 1,5-Dichloro-2-nitro-4-(trifluoromethyl)benzene, it is essential to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...