Compound Q&A

How is 1,5-Dichloro-2-nitro-4-(trifluoromethyl)benzene (CAS: 400-70-4) typically synthesized?

Answer

1,5-Dichloro-2-nitro-4-(trifluoromethyl)benzene
1,5-Dichloro-2-nitro-4-(trifluoromethyl)benzene is typically synthesized via the Friedel-Crafts alkylation of 2-nitro-4-(trifluoromethyl)benzene with chlorine, followed by nitration. The reaction is usually carried out under anhydrous conditions with a Lewis acid catalyst such as aluminum chloride (AlCl3). The yield is moderate, around 50-70%, depending on the purity and handling of reactants.

About

CAS No 400-70-4
English Name 1,5-Dichloro-2-nitro-4-(trifluoromethyl)benzene
Molecular Formula C7H2Cl2F3NO2
Molecular Weight 259.99 g/mol
SMILES C1=C(C(=CC(=C1[N+](=O)[O-])Cl)Cl)C(F)(F)F
InChIKey VLVNHMVSVDVAOA-UHFFFAOYSA-N
Last Updated: 2025-10-22 12:37

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,5-Dichloro-2-nitro-4-(trifluoromethyl)benzene (CAS: 400-70-4)?

1,5-Dichloro-2-nitro-4-(trifluoromethyl)benzene is a crystalline solid with a molecular weight of ap...

Compound Q&A

What industries use 1,5-Dichloro-2-nitro-4-(trifluoromethyl)benzene (CAS: 400-70-4)?

1,5-Dichloro-2-nitro-4-(trifluoromethyl)benzene is used in the pharmaceutical industry for the synth...

Compound Q&A

What precautions should be taken when handling 1,5-Dichloro-2-nitro-4-(trifluoromethyl)benzene (CAS: 400-70-4)?

When handling 1,5-Dichloro-2-nitro-4-(trifluoromethyl)benzene, it is essential to wear appropriate p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...