Compound Q&A

What is the market or research trend for 7-chloro-N-(3-chloro-4-fluorophenyl)-6-nitroquinazolin-4-amine?

Answer

7-chloro-N-(3-chloro-4-fluorophenyl)-6-nitroquinazolin-4-amine
The research and market trends for 7-chloro-N-(3-chloro-4-fluorophenyl)-6-nitroquinazolin-4-amine indicate increasing interest in its potential applications in medicinal chemistry and synthetic biology. The compound is often studied for its biological activity, particularly in the development of novel pharmaceuticals. Market trends suggest a growing emphasis on optimizing synthesis methods and improving the compound’s therapeutic potential. Additionally, research is focusing on its role in exploring new drug targets and understanding its biochemical interactions.

About

English Name 7-chloro-N-(3-chloro-4-fluorophenyl)-6-nitroquinazolin-4-amine
Molecular Formula C14H7Cl2FN4O2
Molecular Weight 353.14 g/mol
SMILES C1=CC(=C(C=C1NC2=NC=NC3=CC(=C(C=C32)[N+](=O)[O-])Cl)Cl)F
InChIKey ALJPGKSDBZFNBR-UHFFFAOYSA-N
Last Updated: 2025-10-20 12:31

Related Q&A

Compound Q&A

What regulatory guidelines apply to 7-chloro-N-(3-chloro-4-fluorophenyl)-6-nitroquinazolin-4-amine (CAS: 179552-73-9)?

The compound 7-chloro-N-(3-chloro-4-fluorophenyl)-6-nitroquinazolin-4-amine is subject to various re...

Compound Q&A

Are there alternatives to 7-chloro-N-(3-chloro-4-fluorophenyl)-6-nitroquinazolin-4-amine in synthesis?

There are several alternatives to 7-chloro-N-(3-chloro-4-fluorophenyl)-6-nitroquinazolin-4-amine in ...

Compound Q&A

How should waste containing 7-chloro-N-(3-chloro-4-fluorophenyl)-6-nitroquinazolin-4-amine be handled?

Waste containing 7-chloro-N-(3-chloro-4-fluorophenyl)-6-nitroquinazolin-4-amine should be handled ac...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...