Compound Q&A

Are there alternatives to 7-chloro-N-(3-chloro-4-fluorophenyl)-6-nitroquinazolin-4-amine in synthesis?

Answer

7-chloro-N-(3-chloro-4-fluorophenyl)-6-nitroquinazolin-4-amine
There are several alternatives to 7-chloro-N-(3-chloro-4-fluorophenyl)-6-nitroquinazolin-4-amine in synthesis. For instance, using different functional groups or substituents can lead to the formation of similar nitrogen-containing heterocycles. Common alternative reagents include various aromatics, nitriles, or diazonium salts. These alternatives can offer similar reactivity profiles but with different synthetic pathways and possibly improved safety profiles.

About

English Name 7-chloro-N-(3-chloro-4-fluorophenyl)-6-nitroquinazolin-4-amine
Molecular Formula C14H7Cl2FN4O2
Molecular Weight 353.14 g/mol
SMILES C1=CC(=C(C=C1NC2=NC=NC3=CC(=C(C=C32)[N+](=O)[O-])Cl)Cl)F
InChIKey ALJPGKSDBZFNBR-UHFFFAOYSA-N
Last Updated: 2025-10-20 12:31

Related Q&A

Compound Q&A

What regulatory guidelines apply to 7-chloro-N-(3-chloro-4-fluorophenyl)-6-nitroquinazolin-4-amine (CAS: 179552-73-9)?

The compound 7-chloro-N-(3-chloro-4-fluorophenyl)-6-nitroquinazolin-4-amine is subject to various re...

Compound Q&A

What is the market or research trend for 7-chloro-N-(3-chloro-4-fluorophenyl)-6-nitroquinazolin-4-amine?

The research and market trends for 7-chloro-N-(3-chloro-4-fluorophenyl)-6-nitroquinazolin-4-amine in...

Compound Q&A

How should waste containing 7-chloro-N-(3-chloro-4-fluorophenyl)-6-nitroquinazolin-4-amine be handled?

Waste containing 7-chloro-N-(3-chloro-4-fluorophenyl)-6-nitroquinazolin-4-amine should be handled ac...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...