Compound Q&A

What are the physical and chemical properties of (5-methoxy-1H-indol-2-yl)-phenylmethanone (CAS: 74588-78-6)?

Answer

(5-methoxy-1H-indol-2-yl)-phenylmethanone
(5-methoxy-1H-indol-2-yl)-phenylmethanone (CAS: 74588-78-6) has a white crystalline form with a molecular weight of approximately 260.26 g/mol. It is slightly soluble in water but soluble in organic solvents like ethanol and acetone. Chemically, it is stable under normal conditions but reacts with strong acids and bases. It is a key intermediate in the synthesis of various indole derivatives used in pharmaceuticals and agrochemicals.

About

CAS No 74588-78-6
English Name (5-methoxy-1H-indol-2-yl)-phenylmethanone
Molecular Formula C16H13NO2
Molecular Weight 251.29 g/mol
SMILES COC1=CC2=C(C=C1)NC(=C2)C(=O)C3=CC=CC=C3
InChIKey ICMIJSRDISNKOC-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

How is (5-methoxy-1H-indol-2-yl)-phenylmethanone (CAS: 74588-78-6) typically synthesized?

(5-methoxy-1H-indol-2-yl)-phenylmethanone (CAS: 74588-78-6) is typically synthesized by the condensa...

Compound Q&A

What industries use (5-methoxy-1H-indol-2-yl)-phenylmethanone (CAS: 74588-78-6)?

(5-methoxy-1H-indol-2-yl)-phenylmethanone (CAS: 74588-78-6) is used in the pharmaceutical industry f...

Compound Q&A

What precautions should be taken when handling (5-methoxy-1H-indol-2-yl)-phenylmethanone (CAS: 74588-78-6)?

When handling (5-methoxy-1H-indol-2-yl)-phenylmethanone (CAS: 74588-78-6), it is essential to use pr...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...