Compound Q&A

What industries use 1-(4-Nitrophenyl)ethanol (CAS: 6531-13-1)?

Answer

1-(4-Nitrophenyl)ethanol
1-(4-Nitrophenyl)ethanol (CAS: 6531-13-1) is used in the pharmaceutical industry for the synthesis of certain drug molecules. It is also utilized in the chemical industry for the production of dyes and pigments. Additionally, it serves as a reagent in polymer chemistry and as a precursor in the development of sensors and semiconductors.

About

CAS No 6531-13-1
English Name 1-(4-Nitrophenyl)ethanol
Molecular Formula C8H9NO3
Molecular Weight 167.16 g/mol
SMILES CC(C1=CC=C(C=C1)[N+](=O)[O-])O
InChIKey CRJFHXYELTYDSG-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(4-Nitrophenyl)ethanol (CAS: 6531-13-1)?

1-(4-Nitrophenyl)ethanol (CAS: 6531-13-1) is a colorless liquid with a molecular weight of 190.13 g/...

Compound Q&A

How is 1-(4-Nitrophenyl)ethanol (CAS: 6531-13-1) typically synthesized?

1-(4-Nitrophenyl)ethanol is typically synthesized by the nitration of 1-phenylethanol followed by hy...

Compound Q&A

What precautions should be taken when handling 1-(4-Nitrophenyl)ethanol (CAS: 6531-13-1)?

When handling 1-(4-Nitrophenyl)ethanol (CAS: 6531-13-1), it is important to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...