Compound Q&A

How is 1-(4-Nitrophenyl)ethanol (CAS: 6531-13-1) typically synthesized?

Answer

1-(4-Nitrophenyl)ethanol
1-(4-Nitrophenyl)ethanol is typically synthesized by the nitration of 1-phenylethanol followed by hydrolysis. This involves treating 1-phenylethanol with a mixture of concentrated sulfuric acid and nitric acid under controlled temperature conditions. The nitration step requires careful monitoring to achieve the desired yield and selectivity.

About

CAS No 6531-13-1
English Name 1-(4-Nitrophenyl)ethanol
Molecular Formula C8H9NO3
Molecular Weight 167.16 g/mol
SMILES CC(C1=CC=C(C=C1)[N+](=O)[O-])O
InChIKey CRJFHXYELTYDSG-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-(4-Nitrophenyl)ethanol (CAS: 6531-13-1)?

1-(4-Nitrophenyl)ethanol (CAS: 6531-13-1) is a colorless liquid with a molecular weight of 190.13 g/...

Compound Q&A

What industries use 1-(4-Nitrophenyl)ethanol (CAS: 6531-13-1)?

1-(4-Nitrophenyl)ethanol (CAS: 6531-13-1) is used in the pharmaceutical industry for the synthesis o...

Compound Q&A

What precautions should be taken when handling 1-(4-Nitrophenyl)ethanol (CAS: 6531-13-1)?

When handling 1-(4-Nitrophenyl)ethanol (CAS: 6531-13-1), it is important to wear appropriate persona...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...