Compound Q&A

What precautions should be taken when handling 2-Chloroadenosine Hemihydrate (CAS: 81012-94-4)?

Answer

2-Chloroadenosine Hemihydrate
When handling 2-Chloroadenosine Hemihydrate, use personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work in a fume hood to minimize exposure. Spills should be cleaned up using absorbent materials, and the area should be washed with water. Always consult the Safety Data Sheet (SDS) for detailed handling and emergency procedures.

About

CAS No 81012-94-4
English Name 2-Chloroadenosine Hemihydrate
Molecular Formula C20H26Cl2N10O9
Molecular Weight 621.4 g/mol
SMILES C1=NC2=C(N=C(N=C2N1C3C(C(C(O3)CO)O)O)Cl)N.C1=NC2=C(N=C(N=C2N1C3C(C(C(O3)CO)O)O)Cl)N.O
InChIKey WRURCFOLSGPTMO-IZGCVNAISA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Chloroadenosine Hemihydrate (CAS: 81012-94-4)?

2-Chloroadenosine Hemihydrate has a crystalline form with a molecular weight of approximately 387.02...

Compound Q&A

How is 2-Chloroadenosine Hemihydrate (CAS: 81012-94-4) typically synthesized?

2-Chloroadenosine Hemihydrate is typically synthesized by the chlorination of adenine in the presenc...

Compound Q&A

What industries use 2-Chloroadenosine Hemihydrate (CAS: 81012-94-4)?

2-Chloroadenosine Hemihydrate is primarily used in the pharmaceutical industry for its potential as ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...