Compound Q&A

What industries use 2-Chloroadenosine Hemihydrate (CAS: 81012-94-4)?

Answer

2-Chloroadenosine Hemihydrate
2-Chloroadenosine Hemihydrate is primarily used in the pharmaceutical industry for its potential as a research tool in studying adenosine receptor pharmacology. It is also used in some analytical and biosensor applications due to its unique chemical properties.

About

CAS No 81012-94-4
English Name 2-Chloroadenosine Hemihydrate
Molecular Formula C20H26Cl2N10O9
Molecular Weight 621.4 g/mol
SMILES C1=NC2=C(N=C(N=C2N1C3C(C(C(O3)CO)O)O)Cl)N.C1=NC2=C(N=C(N=C2N1C3C(C(C(O3)CO)O)O)Cl)N.O
InChIKey WRURCFOLSGPTMO-IZGCVNAISA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Chloroadenosine Hemihydrate (CAS: 81012-94-4)?

2-Chloroadenosine Hemihydrate has a crystalline form with a molecular weight of approximately 387.02...

Compound Q&A

How is 2-Chloroadenosine Hemihydrate (CAS: 81012-94-4) typically synthesized?

2-Chloroadenosine Hemihydrate is typically synthesized by the chlorination of adenine in the presenc...

Compound Q&A

What precautions should be taken when handling 2-Chloroadenosine Hemihydrate (CAS: 81012-94-4)?

When handling 2-Chloroadenosine Hemihydrate, use personal protective equipment (PPE) such as gloves,...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...