Compound Q&A

What industries use (2R)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-pentynoic acid (CAS: 220497-98-3)?

Answer

(2R)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-pentynoic acid
This compound is primarily used in the pharmaceutical industry as a key intermediate in the synthesis of various bioactive compounds. It is also utilized in the polymer industry for the development of novel materials with enhanced properties, and in the chemical sensor industry for the fabrication of highly sensitive detection devices.

About

English Name (2R)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-pentynoic acid
Molecular Formula C20H17NO4
Molecular Weight 335.4 g/mol
SMILES C#CCC(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13
InChIKey DJGMNCKHNMRKFM-GOSISDBHSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2R)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-pentynoic acid (CAS: 220497-98-3)?

This compound is a white to off-white crystalline solid with a molecular weight of approximately 347...

Compound Q&A

How is (2R)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-pentynoic acid (CAS: 220497-98-3) typically synthesized?

The compound is typically synthesized via a Fmoc (Fluorenylmethoxycarbonyl) protection strategy. The...

Compound Q&A

What precautions should be taken when handling (2R)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-pentynoic acid (CAS: 220497-98-3)?

When handling this compound, it is essential to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...