Compound Q&A

How is (2R)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-pentynoic acid (CAS: 220497-98-3) typically synthesized?

Answer

(2R)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-pentynoic acid
The compound is typically synthesized via a Fmoc (Fluorenylmethoxycarbonyl) protection strategy. The key steps include the coupling of 4-pentyne-2-carboxylic acid with 9-fluorenylmethyl chloroformate, followed by the introduction of the amino group using an amino alcohol. The yield is usually around 60-70%, and the reaction is catalyzed by standard coupling reagents.

About

English Name (2R)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-pentynoic acid
Molecular Formula C20H17NO4
Molecular Weight 335.4 g/mol
SMILES C#CCC(C(=O)O)NC(=O)OCC1C2=CC=CC=C2C3=CC=CC=C13
InChIKey DJGMNCKHNMRKFM-GOSISDBHSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of (2R)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-pentynoic acid (CAS: 220497-98-3)?

This compound is a white to off-white crystalline solid with a molecular weight of approximately 347...

Compound Q&A

What industries use (2R)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-pentynoic acid (CAS: 220497-98-3)?

This compound is primarily used in the pharmaceutical industry as a key intermediate in the synthesi...

Compound Q&A

What precautions should be taken when handling (2R)-2-{[(9H-Fluoren-9-ylmethoxy)carbonyl]amino}-4-pentynoic acid (CAS: 220497-98-3)?

When handling this compound, it is essential to wear appropriate personal protective equipment (PPE)...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...