Compound Q&A

What industries use 2-Methyl-2-propanyl 4-fluoro-4-(hydroxymethyl)-1-piperidinecarboxylate (CAS: 614730-97-1)?

Answer

2-Methyl-2-propanyl 4-fluoro-4-(hydroxymethyl)-1-piperidinecarboxylate
2-Methyl-2-propanyl 4-fluoro-4-(hydroxymethyl)-1-piperidinecarboxylate is primarily used in the pharmaceutical industry for the synthesis of drug candidates. It also finds applications in the polymer industry for modifying polymer properties and in sensor technology for developing highly sensitive detection systems. Its use in semiconductor manufacturing for specific etching and cleaning processes is also documented, although less common.

About

English Name 2-Methyl-2-propanyl 4-fluoro-4-(hydroxymethyl)-1-piperidinecarboxylate
Molecular Formula C11H20FNO3
Molecular Weight 233.28 g/mol
SMILES CC(C)(C)OC(=O)N1CCC(CC1)(CO)F
InChIKey BWZOULIMVKCGII-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 4-fluoro-4-(hydroxymethyl)-1-piperidinecarboxylate (CAS: 614730-97-1)?

2-Methyl-2-propanyl 4-fluoro-4-(hydroxymethyl)-1-piperidinecarboxylate is a colorless liquid with a ...

Compound Q&A

How is 2-Methyl-2-propanyl 4-fluoro-4-(hydroxymethyl)-1-piperidinecarboxylate (CAS: 614730-97-1) typically synthesized?

2-Methyl-2-propanyl 4-fluoro-4-(hydroxymethyl)-1-piperidinecarboxylate is typically synthesized thro...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 4-fluoro-4-(hydroxymethyl)-1-piperidinecarboxylate (CAS: 614730-97-1)?

When handling 2-Methyl-2-propanyl 4-fluoro-4-(hydroxymethyl)-1-piperidinecarboxylate, it is essentia...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...