Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 4-fluoro-4-(hydroxymethyl)-1-piperidinecarboxylate (CAS: 614730-97-1)?

Answer

2-Methyl-2-propanyl 4-fluoro-4-(hydroxymethyl)-1-piperidinecarboxylate
2-Methyl-2-propanyl 4-fluoro-4-(hydroxymethyl)-1-piperidinecarboxylate is a colorless liquid with a molecular weight of approximately 263.18 g/mol. It has a high solubility in organic solvents but is poorly soluble in water. This compound is known for its reactivity, particularly in nucleophilic substitution reactions. It crystallizes in the form of colorless needles at a specific melting point. It is used in the synthesis of various pharmaceuticals and is characterized by its stability under normal storage conditions.

About

English Name 2-Methyl-2-propanyl 4-fluoro-4-(hydroxymethyl)-1-piperidinecarboxylate
Molecular Formula C11H20FNO3
Molecular Weight 233.28 g/mol
SMILES CC(C)(C)OC(=O)N1CCC(CC1)(CO)F
InChIKey BWZOULIMVKCGII-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl 4-fluoro-4-(hydroxymethyl)-1-piperidinecarboxylate (CAS: 614730-97-1) typically synthesized?

2-Methyl-2-propanyl 4-fluoro-4-(hydroxymethyl)-1-piperidinecarboxylate is typically synthesized thro...

Compound Q&A

What industries use 2-Methyl-2-propanyl 4-fluoro-4-(hydroxymethyl)-1-piperidinecarboxylate (CAS: 614730-97-1)?

2-Methyl-2-propanyl 4-fluoro-4-(hydroxymethyl)-1-piperidinecarboxylate is primarily used in the phar...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 4-fluoro-4-(hydroxymethyl)-1-piperidinecarboxylate (CAS: 614730-97-1)?

When handling 2-Methyl-2-propanyl 4-fluoro-4-(hydroxymethyl)-1-piperidinecarboxylate, it is essentia...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...