Compound Q&A

How is 2-Methyl-2-propanyl 4-fluoro-4-(hydroxymethyl)-1-piperidinecarboxylate (CAS: 614730-97-1) typically synthesized?

Answer

2-Methyl-2-propanyl 4-fluoro-4-(hydroxymethyl)-1-piperidinecarboxylate
2-Methyl-2-propanyl 4-fluoro-4-(hydroxymethyl)-1-piperidinecarboxylate is typically synthesized through a multi-step process involving the protection of a carboxylic acid, followed by a fluoroalkylation reaction. Catalysts such as NaH or other alkali metal hydrides are commonly used. The overall yield is moderate, and the reaction requires precise control of temperature and base concentration to achieve high selectivity and purity. Detailed synthesis protocols and reaction conditions are available in literature and patents.

About

English Name 2-Methyl-2-propanyl 4-fluoro-4-(hydroxymethyl)-1-piperidinecarboxylate
Molecular Formula C11H20FNO3
Molecular Weight 233.28 g/mol
SMILES CC(C)(C)OC(=O)N1CCC(CC1)(CO)F
InChIKey BWZOULIMVKCGII-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 4-fluoro-4-(hydroxymethyl)-1-piperidinecarboxylate (CAS: 614730-97-1)?

2-Methyl-2-propanyl 4-fluoro-4-(hydroxymethyl)-1-piperidinecarboxylate is a colorless liquid with a ...

Compound Q&A

What industries use 2-Methyl-2-propanyl 4-fluoro-4-(hydroxymethyl)-1-piperidinecarboxylate (CAS: 614730-97-1)?

2-Methyl-2-propanyl 4-fluoro-4-(hydroxymethyl)-1-piperidinecarboxylate is primarily used in the phar...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 4-fluoro-4-(hydroxymethyl)-1-piperidinecarboxylate (CAS: 614730-97-1)?

When handling 2-Methyl-2-propanyl 4-fluoro-4-(hydroxymethyl)-1-piperidinecarboxylate, it is essentia...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...