Compound Q&A

What precautions should be taken when handling 1-Acetyl-5-(2-aminopropyl)-1H-indole-7-carbonitrile (CAS: 175837-01-1)?

Answer

1-Acetyl-5-(2-aminopropyl)-1H-indole-7-carbonitrile
When handling 1-Acetyl-5-(2-aminopropyl)-1H-indole-7-carbonitrile, it is crucial to wear appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Ensure the work is conducted in a well-ventilated area, preferably a fume hood, to minimize exposure to the compound. Spills should be cleaned up immediately using appropriate spill kits, and the area should be thoroughly rinsed. Always refer to the Safety Data Sheet (SDS) for detailed safety information and emergency procedures.

About

English Name 1-Acetyl-5-(2-aminopropyl)-1H-indole-7-carbonitrile
Molecular Formula C14H15N3O
Molecular Weight 243.3 g/mol
SMILES CC(CC1=CC2=C(C(=C1)C#N)N(CC2)C(=O)C)N
InChIKey DNFHMDAQSKREOD-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1-Acetyl-5-(2-aminopropyl)-1H-indole-7-carbonitrile (CAS: 175837-01-1)?

1-Acetyl-5-(2-aminopropyl)-1H-indole-7-carbonitrile is a solid compound with a crystalline form. Its...

Compound Q&A

How is 1-Acetyl-5-(2-aminopropyl)-1H-indole-7-carbonitrile (CAS: 175837-01-1) typically synthesized?

1-Acetyl-5-(2-aminopropyl)-1H-indole-7-carbonitrile is synthesized through a multi-step process invo...

Compound Q&A

What industries use 1-Acetyl-5-(2-aminopropyl)-1H-indole-7-carbonitrile (CAS: 175837-01-1)?

1-Acetyl-5-(2-aminopropyl)-1H-indole-7-carbonitrile is primarily used in the pharmaceutical industry...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...