Compound Q&A

What industries use Ethyl 6-bromo-1H-indazole-3-carboxylate (CAS: 885272-94-6)?

Answer

Ethyl 6-bromo-1H-indazole-3-carboxylate
Ethyl 6-bromo-1H-indazole-3-carboxylate (CAS: 885272-94-6) is primarily used in the pharmaceutical industry due to its potential as a precursor in the synthesis of various bioactive compounds. It also finds applications in the chemical industry for its reactivity in organic synthesis and in the development of new materials. This compound is less commonly used in the polymer or semiconductor industries but can be utilized in specialized applications requiring its specific reactivity.

About

English Name Ethyl 6-bromo-1H-indazole-3-carboxylate
Molecular Formula C10H9BrN2O2
Molecular Weight 269.1 g/mol
SMILES CCOC(=O)C1=NNC2=C1C=CC(=C2)Br
InChIKey QJWRLFKJCOFQIS-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 6-bromo-1H-indazole-3-carboxylate (CAS: 885272-94-6)?

Ethyl 6-bromo-1H-indazole-3-carboxylate (CAS: 885272-94-6) is a white crystalline solid with a molec...

Compound Q&A

How is Ethyl 6-bromo-1H-indazole-3-carboxylate (CAS: 885272-94-6) typically synthesized?

Ethyl 6-bromo-1H-indazole-3-carboxylate is synthesized through a multi-step process involving the sy...

Compound Q&A

What precautions should be taken when handling Ethyl 6-bromo-1H-indazole-3-carboxylate (CAS: 885272-94-6)?

When handling Ethyl 6-bromo-1H-indazole-3-carboxylate (CAS: 885272-94-6), it is essential to wear ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...