Compound Q&A

How is Ethyl 6-bromo-1H-indazole-3-carboxylate (CAS: 885272-94-6) typically synthesized?

Answer

Ethyl 6-bromo-1H-indazole-3-carboxylate
Ethyl 6-bromo-1H-indazole-3-carboxylate is synthesized through a multi-step process involving the synthesis of 1H-indazole followed by alkylation with ethyl bromide, followed by acylation with ethyl chloroformate. The reaction typically requires the use of a base like triethylamine and is achieved with high yield and selectivity. The process is conducted under standard laboratory conditions, with appropriate handling of bromine and ethyl bromide due to their reactivity.

About

English Name Ethyl 6-bromo-1H-indazole-3-carboxylate
Molecular Formula C10H9BrN2O2
Molecular Weight 269.1 g/mol
SMILES CCOC(=O)C1=NNC2=C1C=CC(=C2)Br
InChIKey QJWRLFKJCOFQIS-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of Ethyl 6-bromo-1H-indazole-3-carboxylate (CAS: 885272-94-6)?

Ethyl 6-bromo-1H-indazole-3-carboxylate (CAS: 885272-94-6) is a white crystalline solid with a molec...

Compound Q&A

What industries use Ethyl 6-bromo-1H-indazole-3-carboxylate (CAS: 885272-94-6)?

Ethyl 6-bromo-1H-indazole-3-carboxylate (CAS: 885272-94-6) is primarily used in the pharmaceutical i...

Compound Q&A

What precautions should be taken when handling Ethyl 6-bromo-1H-indazole-3-carboxylate (CAS: 885272-94-6)?

When handling Ethyl 6-bromo-1H-indazole-3-carboxylate (CAS: 885272-94-6), it is essential to wear ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...