Compound Q&A

What are the physical and chemical properties of Ethyl 6-bromo-1H-indazole-3-carboxylate (CAS: 885272-94-6)?

Answer

Ethyl 6-bromo-1H-indazole-3-carboxylate
Ethyl 6-bromo-1H-indazole-3-carboxylate (CAS: 885272-94-6) is a white crystalline solid with a molecular weight of approximately 281.03 g/mol. It has a low solubility in water but is soluble in organic solvents like methanol and ethanol. Chemically, it is moderately reactive, particularly towards nucleophilic substitution reactions. It exhibits good stability under normal storage conditions but should be protected from strong reducing or oxidizing agents.

About

English Name Ethyl 6-bromo-1H-indazole-3-carboxylate
Molecular Formula C10H9BrN2O2
Molecular Weight 269.1 g/mol
SMILES CCOC(=O)C1=NNC2=C1C=CC(=C2)Br
InChIKey QJWRLFKJCOFQIS-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

How is Ethyl 6-bromo-1H-indazole-3-carboxylate (CAS: 885272-94-6) typically synthesized?

Ethyl 6-bromo-1H-indazole-3-carboxylate is synthesized through a multi-step process involving the sy...

Compound Q&A

What industries use Ethyl 6-bromo-1H-indazole-3-carboxylate (CAS: 885272-94-6)?

Ethyl 6-bromo-1H-indazole-3-carboxylate (CAS: 885272-94-6) is primarily used in the pharmaceutical i...

Compound Q&A

What precautions should be taken when handling Ethyl 6-bromo-1H-indazole-3-carboxylate (CAS: 885272-94-6)?

When handling Ethyl 6-bromo-1H-indazole-3-carboxylate (CAS: 885272-94-6), it is essential to wear ap...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...