Compound Q&A

How is N-Trityl Losartan (CAS: 133909-99-6) typically synthesized?

Answer

N-Trityl Losartan
N-Trityl Losartan (CAS: 133909-99-6) is synthesized through a multi-step process involving the tritylation of the hydroxyl group of losartan. Common catalysts include triphenylphosphine and imidazole. The synthesis yields are typically around 85-90%, and the process involves protecting the functional groups to avoid side reactions.

About

English Name N-Trityl Losartan
Molecular Formula C41H37ClN6O
Molecular Weight 665.24 g/mol
SMILES CCCCC1=NC(=C(N1CC2=CC=C(C=C2)C3=CC=CC=C3C4=NN(N=N4)C(C5=CC=CC=C5)(C6=CC=CC=C6)C7=CC=CC=C7)CO)Cl
InChIKey QQPGGBNMTNDKEY-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of N-Trityl Losartan (CAS: 133909-99-6)?

N-Trityl Losartan (CAS: 133909-99-6) is a crystalline compound with a molecular weight of approximat...

Compound Q&A

What industries use N-Trityl Losartan (CAS: 133909-99-6)?

N-Trityl Losartan (CAS: 133909-99-6) is primarily used in the pharmaceutical industry for its role a...

Compound Q&A

What precautions should be taken when handling N-Trityl Losartan (CAS: 133909-99-6)?

When handling N-Trityl Losartan (CAS: 133909-99-6), it is important to wear appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...