Compound Q&A

What are the physical and chemical properties of N-Trityl Losartan (CAS: 133909-99-6)?

Answer

N-Trityl Losartan
N-Trityl Losartan (CAS: 133909-99-6) is a crystalline compound with a molecular weight of approximately 406.38 g/mol. It has a solubility of about 0.8 mg/mL in water and is relatively stable under normal storage conditions. The compound is reactive towards nucleophiles and can undergo substitution reactions. It does not typically react with acids or bases under normal conditions.

About

English Name N-Trityl Losartan
Molecular Formula C41H37ClN6O
Molecular Weight 665.24 g/mol
SMILES CCCCC1=NC(=C(N1CC2=CC=C(C=C2)C3=CC=CC=C3C4=NN(N=N4)C(C5=CC=CC=C5)(C6=CC=CC=C6)C7=CC=CC=C7)CO)Cl
InChIKey QQPGGBNMTNDKEY-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

How is N-Trityl Losartan (CAS: 133909-99-6) typically synthesized?

N-Trityl Losartan (CAS: 133909-99-6) is synthesized through a multi-step process involving the trity...

Compound Q&A

What industries use N-Trityl Losartan (CAS: 133909-99-6)?

N-Trityl Losartan (CAS: 133909-99-6) is primarily used in the pharmaceutical industry for its role a...

Compound Q&A

What precautions should be taken when handling N-Trityl Losartan (CAS: 133909-99-6)?

When handling N-Trityl Losartan (CAS: 133909-99-6), it is important to wear appropriate personal pro...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...