Compound Q&A

What industries use 4-Hydroxy-6-methyl-3-nitro-2(1H)-pyridinone (CAS: 4966-90-9)?

Answer

4-Hydroxy-6-methyl-3-nitro-2(1H)-pyridinone
4-Hydroxy-6-methyl-3-nitro-2(1H)-pyridinone is used in various industries, particularly in pharmaceuticals for its role as an intermediate in the synthesis of certain drugs. It is also utilized in the production of polymers, sensors, and semiconductors due to its unique chemical properties. Its reactivity and functionality make it a valuable compound in these applications.

About

CAS No 4966-90-9
English Name 4-Hydroxy-6-methyl-3-nitro-2(1H)-pyridinone
Molecular Formula C6H6N2O4
Molecular Weight 170.12 g/mol
SMILES CC1=CC(=C(C(=O)N1)[N+](=O)[O-])O
InChIKey QIKWTNPFTOEELW-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Hydroxy-6-methyl-3-nitro-2(1H)-pyridinone (CAS: 4966-90-9)?

4-Hydroxy-6-methyl-3-nitro-2(1H)-pyridinone is a crystalline compound with a molecular weight of app...

Compound Q&A

How is 4-Hydroxy-6-methyl-3-nitro-2(1H)-pyridinone (CAS: 4966-90-9) typically synthesized?

4-Hydroxy-6-methyl-3-nitro-2(1H)-pyridinone can be synthesized via nitration of 4-hydroxy-6-methyl-2...

Compound Q&A

What precautions should be taken when handling 4-Hydroxy-6-methyl-3-nitro-2(1H)-pyridinone (CAS: 4966-90-9)?

Proper safety measures are essential when handling 4-Hydroxy-6-methyl-3-nitro-2(1H)-pyridinone. Alwa...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...