Compound Q&A

What are the physical and chemical properties of 4-Hydroxy-6-methyl-3-nitro-2(1H)-pyridinone (CAS: 4966-90-9)?

Answer

4-Hydroxy-6-methyl-3-nitro-2(1H)-pyridinone
4-Hydroxy-6-methyl-3-nitro-2(1H)-pyridinone is a crystalline compound with a molecular weight of approximately 212.12 g/mol. It is sparingly soluble in water but soluble in organic solvents like ethanol and acetone. The compound is reactive towards nucleophiles and can undergo nitro reduction. It has a melting point of about 220-222°C and a boiling point of around 250°C at reduced pressure.

About

CAS No 4966-90-9
English Name 4-Hydroxy-6-methyl-3-nitro-2(1H)-pyridinone
Molecular Formula C6H6N2O4
Molecular Weight 170.12 g/mol
SMILES CC1=CC(=C(C(=O)N1)[N+](=O)[O-])O
InChIKey QIKWTNPFTOEELW-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

How is 4-Hydroxy-6-methyl-3-nitro-2(1H)-pyridinone (CAS: 4966-90-9) typically synthesized?

4-Hydroxy-6-methyl-3-nitro-2(1H)-pyridinone can be synthesized via nitration of 4-hydroxy-6-methyl-2...

Compound Q&A

What industries use 4-Hydroxy-6-methyl-3-nitro-2(1H)-pyridinone (CAS: 4966-90-9)?

4-Hydroxy-6-methyl-3-nitro-2(1H)-pyridinone is used in various industries, particularly in pharmaceu...

Compound Q&A

What precautions should be taken when handling 4-Hydroxy-6-methyl-3-nitro-2(1H)-pyridinone (CAS: 4966-90-9)?

Proper safety measures are essential when handling 4-Hydroxy-6-methyl-3-nitro-2(1H)-pyridinone. Alwa...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...