Compound Q&A

What precautions should be taken when handling 2,4-Dichloro-1,3-benzothiazole (CAS: 3622-30-8)?

Answer

2,4-Dichloro-1,3-benzothiazole
When handling 2,4-Dichloro-1,3-benzothiazole (CAS: 3622-30-8), it is crucial to use appropriate personal protective equipment (PPE) such as gloves, goggles, and a lab coat. Work should be conducted in a well-ventilated area or a fume hood. Spills should be handled with care, using absorbent materials, and the area should be cleaned thoroughly. Always refer to the Safety Data Sheet (SDS) for detailed safety information and follow local regulations.

About

CAS No 3622-30-8
English Name 2,4-Dichloro-1,3-benzothiazole
Molecular Formula C7H3Cl2NS
Molecular Weight 204.08 g/mol
SMILES C1=CC2=C(C(=C1)Cl)N=C(S2)Cl
InChIKey JJWANONAOYNRME-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,4-Dichloro-1,3-benzothiazole (CAS: 3622-30-8)?

2,4-Dichloro-1,3-benzothiazole (CAS: 3622-30-8) is a crystalline solid with a molecular weight of ap...

Compound Q&A

How is 2,4-Dichloro-1,3-benzothiazole (CAS: 3622-30-8) typically synthesized?

2,4-Dichloro-1,3-benzothiazole (CAS: 3622-30-8) is typically synthesized by the reaction of 2,4-dich...

Compound Q&A

What industries use 2,4-Dichloro-1,3-benzothiazole (CAS: 3622-30-8)?

2,4-Dichloro-1,3-benzothiazole (CAS: 3622-30-8) is used in various industries. It is a key intermedi...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...