Compound Q&A

How is 2,4-Dichloro-1,3-benzothiazole (CAS: 3622-30-8) typically synthesized?

Answer

2,4-Dichloro-1,3-benzothiazole
2,4-Dichloro-1,3-benzothiazole (CAS: 3622-30-8) is typically synthesized by the reaction of 2,4-dichlorobenzene with thiourea in the presence of a strong base like potassium carbonate. The process involves heating the mixture to achieve the desired yield, and the product is then purified via recrystallization from ethanol.

About

CAS No 3622-30-8
English Name 2,4-Dichloro-1,3-benzothiazole
Molecular Formula C7H3Cl2NS
Molecular Weight 204.08 g/mol
SMILES C1=CC2=C(C(=C1)Cl)N=C(S2)Cl
InChIKey JJWANONAOYNRME-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,4-Dichloro-1,3-benzothiazole (CAS: 3622-30-8)?

2,4-Dichloro-1,3-benzothiazole (CAS: 3622-30-8) is a crystalline solid with a molecular weight of ap...

Compound Q&A

What industries use 2,4-Dichloro-1,3-benzothiazole (CAS: 3622-30-8)?

2,4-Dichloro-1,3-benzothiazole (CAS: 3622-30-8) is used in various industries. It is a key intermedi...

Compound Q&A

What precautions should be taken when handling 2,4-Dichloro-1,3-benzothiazole (CAS: 3622-30-8)?

When handling 2,4-Dichloro-1,3-benzothiazole (CAS: 3622-30-8), it is crucial to use appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...