Compound Q&A

What industries use 2,4-Dichloro-1,3-benzothiazole (CAS: 3622-30-8)?

Answer

2,4-Dichloro-1,3-benzothiazole
2,4-Dichloro-1,3-benzothiazole (CAS: 3622-30-8) is used in various industries. It is a key intermediate in the synthesis of pharmaceuticals, particularly for antifungal and anticancer drugs. It also finds applications in the production of polymers, sensors, and in organic semiconductor materials.

About

CAS No 3622-30-8
English Name 2,4-Dichloro-1,3-benzothiazole
Molecular Formula C7H3Cl2NS
Molecular Weight 204.08 g/mol
SMILES C1=CC2=C(C(=C1)Cl)N=C(S2)Cl
InChIKey JJWANONAOYNRME-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2,4-Dichloro-1,3-benzothiazole (CAS: 3622-30-8)?

2,4-Dichloro-1,3-benzothiazole (CAS: 3622-30-8) is a crystalline solid with a molecular weight of ap...

Compound Q&A

How is 2,4-Dichloro-1,3-benzothiazole (CAS: 3622-30-8) typically synthesized?

2,4-Dichloro-1,3-benzothiazole (CAS: 3622-30-8) is typically synthesized by the reaction of 2,4-dich...

Compound Q&A

What precautions should be taken when handling 2,4-Dichloro-1,3-benzothiazole (CAS: 3622-30-8)?

When handling 2,4-Dichloro-1,3-benzothiazole (CAS: 3622-30-8), it is crucial to use appropriate pers...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...