Compound Q&A

What industries use 4-bromo-1H-indazole-6-carboxylic acid (CAS: 885523-43-3)?

Answer

4-bromo-1H-indazole-6-carboxylic acid
4-Bromo-1H-indazole-6-carboxylic acid is primarily used in the pharmaceutical and chemical industries for the synthesis of various intermediates and drugs. It also finds applications in the development of specialized polymers, sensors, and materials for semiconductor devices due to its unique chemical properties.

About

English Name 4-bromo-1H-indazole-6-carboxylic acid
Molecular Formula C8H5BrN2O2
Molecular Weight 241.04 g/mol
SMILES C1=C(C=C(C2=C1NN=C2)Br)C(=O)O
InChIKey PTPANGLJLZZYNH-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-bromo-1H-indazole-6-carboxylic acid (CAS: 885523-43-3)?

4-Bromo-1H-indazole-6-carboxylic acid is a crystalline solid with a molecular weight of approximatel...

Compound Q&A

How is 4-bromo-1H-indazole-6-carboxylic acid (CAS: 885523-43-3) typically synthesized?

4-Bromo-1H-indazole-6-carboxylic acid is commonly synthesized via the bromination of indazole-6-carb...

Compound Q&A

What precautions should be taken when handling 4-bromo-1H-indazole-6-carboxylic acid (CAS: 885523-43-3)?

When handling 4-bromo-1H-indazole-6-carboxylic acid, it is essential to wear protective equipment in...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...