Compound Q&A

How is 4-bromo-1H-indazole-6-carboxylic acid (CAS: 885523-43-3) typically synthesized?

Answer

4-bromo-1H-indazole-6-carboxylic acid
4-Bromo-1H-indazole-6-carboxylic acid is commonly synthesized via the bromination of indazole-6-carboxylic acid followed by a carboxylic acid condensation reaction. The key steps involve the bromination of the indazole ring, which can be achieved using N-bromosuccinimide (NBS) in an appropriate solvent. The product is purified by recrystallization from water or organic solvents.

About

English Name 4-bromo-1H-indazole-6-carboxylic acid
Molecular Formula C8H5BrN2O2
Molecular Weight 241.04 g/mol
SMILES C1=C(C=C(C2=C1NN=C2)Br)C(=O)O
InChIKey PTPANGLJLZZYNH-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-bromo-1H-indazole-6-carboxylic acid (CAS: 885523-43-3)?

4-Bromo-1H-indazole-6-carboxylic acid is a crystalline solid with a molecular weight of approximatel...

Compound Q&A

What industries use 4-bromo-1H-indazole-6-carboxylic acid (CAS: 885523-43-3)?

4-Bromo-1H-indazole-6-carboxylic acid is primarily used in the pharmaceutical and chemical industrie...

Compound Q&A

What precautions should be taken when handling 4-bromo-1H-indazole-6-carboxylic acid (CAS: 885523-43-3)?

When handling 4-bromo-1H-indazole-6-carboxylic acid, it is essential to wear protective equipment in...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...