Compound Q&A

What industries use 6-Chloro-1H-indazole-3-carboxylic acid (CAS: 129295-31-4)?

Answer

6-Chloro-1H-indazole-3-carboxylic acid
6-Chloro-1H-indazole-3-carboxylic acid is primarily used in the pharmaceutical industry as an intermediate for the synthesis of various drugs. It is also utilized in the production of organic semiconductors and as a component in some polymer formulations, although its specific applications in these areas are more limited compared to its pharmaceutical uses.

About

English Name 6-Chloro-1H-indazole-3-carboxylic acid
Molecular Formula C8H5ClN2O2
Molecular Weight 196.59 g/mol
SMILES C1=CC2=C(C=C1Cl)NN=C2C(=O)O
InChIKey MCGHMISXTKQRRF-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 6-Chloro-1H-indazole-3-carboxylic acid (CAS: 129295-31-4)?

6-Chloro-1H-indazole-3-carboxylic acid is a crystalline solid with a molecular weight of approximate...

Compound Q&A

How is 6-Chloro-1H-indazole-3-carboxylic acid (CAS: 129295-31-4) typically synthesized?

6-Chloro-1H-indazole-3-carboxylic acid can be synthesized by the condensation of 3-chloroindazole wi...

Compound Q&A

What precautions should be taken when handling 6-Chloro-1H-indazole-3-carboxylic acid (CAS: 129295-31-4)?

When handling 6-Chloro-1H-indazole-3-carboxylic acid, it is important to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...