Compound Q&A

What are the physical and chemical properties of 6-Chloro-1H-indazole-3-carboxylic acid (CAS: 129295-31-4)?

Answer

6-Chloro-1H-indazole-3-carboxylic acid
6-Chloro-1H-indazole-3-carboxylic acid is a crystalline solid with a molecular weight of approximately 220.01 g/mol. It is slightly soluble in water but more soluble in organic solvents like methanol and ethanol. The compound is known for its mild acidity and moderate reactivity, particularly in esterification and amide formation reactions.

About

English Name 6-Chloro-1H-indazole-3-carboxylic acid
Molecular Formula C8H5ClN2O2
Molecular Weight 196.59 g/mol
SMILES C1=CC2=C(C=C1Cl)NN=C2C(=O)O
InChIKey MCGHMISXTKQRRF-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

How is 6-Chloro-1H-indazole-3-carboxylic acid (CAS: 129295-31-4) typically synthesized?

6-Chloro-1H-indazole-3-carboxylic acid can be synthesized by the condensation of 3-chloroindazole wi...

Compound Q&A

What industries use 6-Chloro-1H-indazole-3-carboxylic acid (CAS: 129295-31-4)?

6-Chloro-1H-indazole-3-carboxylic acid is primarily used in the pharmaceutical industry as an interm...

Compound Q&A

What precautions should be taken when handling 6-Chloro-1H-indazole-3-carboxylic acid (CAS: 129295-31-4)?

When handling 6-Chloro-1H-indazole-3-carboxylic acid, it is important to wear appropriate personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...