Compound Q&A

How is 4-(Trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 588702-62-9) typically synthesized?

Answer

4-(Trifluoromethyl)-2-pyridinecarboxylic acid
4-(Trifluoromethyl)-2-pyridinecarboxylic acid can be synthesized via a multi-step process involving the coupling of 2-bromopyridine with trifluoromethyl ketone followed by hydrolysis. The synthesis typically requires the use of catalytic amounts of a transition metal catalyst such as palladium and a base like triphenylphosphine. The product is obtained with good yield and selectivity.

About

English Name 4-(Trifluoromethyl)-2-pyridinecarboxylic acid
Molecular Formula C7H4F3NO2
Molecular Weight 191.11 g/mol
SMILES C1=CN=C(C=C1C(F)(F)F)C(=O)O
InChIKey BPRWTROIQXSSOC-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-(Trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 588702-62-9)?

4-(Trifluoromethyl)-2-pyridinecarboxylic acid is a crystalline solid with a molecular weight of appr...

Compound Q&A

What industries use 4-(Trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 588702-62-9)?

4-(Trifluoromethyl)-2-pyridinecarboxylic acid is widely used in the pharmaceutical industry for the ...

Compound Q&A

What precautions should be taken when handling 4-(Trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 588702-62-9)?

When handling 4-(Trifluoromethyl)-2-pyridinecarboxylic acid, it is essential to wear appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...