Compound Q&A

What are the physical and chemical properties of 4-(Trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 588702-62-9)?

Answer

4-(Trifluoromethyl)-2-pyridinecarboxylic acid
4-(Trifluoromethyl)-2-pyridinecarboxylic acid is a crystalline solid with a molecular weight of approximately 218.09 g/mol. It has a low solubility in water but is soluble in common organic solvents such as ethanol and acetonitrile. The compound is relatively stable under normal conditions but can undergo hydrolysis in the presence of moisture. It has a pKa of around 4.5, indicating some acidity.

About

English Name 4-(Trifluoromethyl)-2-pyridinecarboxylic acid
Molecular Formula C7H4F3NO2
Molecular Weight 191.11 g/mol
SMILES C1=CN=C(C=C1C(F)(F)F)C(=O)O
InChIKey BPRWTROIQXSSOC-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

How is 4-(Trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 588702-62-9) typically synthesized?

4-(Trifluoromethyl)-2-pyridinecarboxylic acid can be synthesized via a multi-step process involving ...

Compound Q&A

What industries use 4-(Trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 588702-62-9)?

4-(Trifluoromethyl)-2-pyridinecarboxylic acid is widely used in the pharmaceutical industry for the ...

Compound Q&A

What precautions should be taken when handling 4-(Trifluoromethyl)-2-pyridinecarboxylic acid (CAS: 588702-62-9)?

When handling 4-(Trifluoromethyl)-2-pyridinecarboxylic acid, it is essential to wear appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...