Compound Q&A

What industries use 2-Methyl-2-propanyl 2-cyano-1-piperidinecarboxylate (CAS: 153749-89-4)?

Answer

2-Methyl-2-propanyl 2-cyano-1-piperidinecarboxylate
2-Methyl-2-propanyl 2-cyano-1-piperidinecarboxylate is used in the pharmaceutical industry for the synthesis of various drugs due to its structural properties. It also finds applications in the polymer industry for developing functional polymers. Additionally, it is utilized in the development of sensors and semiconductors for its unique chemical characteristics.

About

English Name 2-Methyl-2-propanyl 2-cyano-1-piperidinecarboxylate
Molecular Formula C11H18N2O2
Molecular Weight 199.29 g/mol
SMILES CC(C)(C)OC(=O)N1CCCCC1C#N
InChIKey LKAJZBMOVZIKHA-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 2-cyano-1-piperidinecarboxylate (CAS: 153749-89-4)?

2-Methyl-2-propanyl 2-cyano-1-piperidinecarboxylate is a crystalline solid with a molecular weight o...

Compound Q&A

How is 2-Methyl-2-propanyl 2-cyano-1-piperidinecarboxylate (CAS: 153749-89-4) typically synthesized?

2-Methyl-2-propanyl 2-cyano-1-piperidinecarboxylate is typically synthesized through a multi-step pr...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 2-cyano-1-piperidinecarboxylate (CAS: 153749-89-4)?

When handling 2-Methyl-2-propanyl 2-cyano-1-piperidinecarboxylate, it is essential to use personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...