Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 2-cyano-1-piperidinecarboxylate (CAS: 153749-89-4)?

Answer

2-Methyl-2-propanyl 2-cyano-1-piperidinecarboxylate
2-Methyl-2-propanyl 2-cyano-1-piperidinecarboxylate is a crystalline solid with a molecular weight of approximately 182.24 g/mol. It is slightly soluble in water and more soluble in organic solvents. Chemically, it is reactive towards nucleophiles and can undergo substitution reactions. The compound is stable under normal conditions but should be stored in a dry, cool place away from direct sunlight.

About

English Name 2-Methyl-2-propanyl 2-cyano-1-piperidinecarboxylate
Molecular Formula C11H18N2O2
Molecular Weight 199.29 g/mol
SMILES CC(C)(C)OC(=O)N1CCCCC1C#N
InChIKey LKAJZBMOVZIKHA-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

How is 2-Methyl-2-propanyl 2-cyano-1-piperidinecarboxylate (CAS: 153749-89-4) typically synthesized?

2-Methyl-2-propanyl 2-cyano-1-piperidinecarboxylate is typically synthesized through a multi-step pr...

Compound Q&A

What industries use 2-Methyl-2-propanyl 2-cyano-1-piperidinecarboxylate (CAS: 153749-89-4)?

2-Methyl-2-propanyl 2-cyano-1-piperidinecarboxylate is used in the pharmaceutical industry for the s...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 2-cyano-1-piperidinecarboxylate (CAS: 153749-89-4)?

When handling 2-Methyl-2-propanyl 2-cyano-1-piperidinecarboxylate, it is essential to use personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...