Compound Q&A

How is 2-Methyl-2-propanyl 2-cyano-1-piperidinecarboxylate (CAS: 153749-89-4) typically synthesized?

Answer

2-Methyl-2-propanyl 2-cyano-1-piperidinecarboxylate
2-Methyl-2-propanyl 2-cyano-1-piperidinecarboxylate is typically synthesized through a multi-step procedure involving the amidation of 2-cyano-1-piperidinecarboxylic acid with 2-methyl-2-propanol. Commonly used catalysts include DMAP, and the reaction proceeds under mild conditions. The yield is typically around 80-85%. The product is purified by recrystallization from appropriate solvents.

About

English Name 2-Methyl-2-propanyl 2-cyano-1-piperidinecarboxylate
Molecular Formula C11H18N2O2
Molecular Weight 199.29 g/mol
SMILES CC(C)(C)OC(=O)N1CCCCC1C#N
InChIKey LKAJZBMOVZIKHA-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 2-Methyl-2-propanyl 2-cyano-1-piperidinecarboxylate (CAS: 153749-89-4)?

2-Methyl-2-propanyl 2-cyano-1-piperidinecarboxylate is a crystalline solid with a molecular weight o...

Compound Q&A

What industries use 2-Methyl-2-propanyl 2-cyano-1-piperidinecarboxylate (CAS: 153749-89-4)?

2-Methyl-2-propanyl 2-cyano-1-piperidinecarboxylate is used in the pharmaceutical industry for the s...

Compound Q&A

What precautions should be taken when handling 2-Methyl-2-propanyl 2-cyano-1-piperidinecarboxylate (CAS: 153749-89-4)?

When handling 2-Methyl-2-propanyl 2-cyano-1-piperidinecarboxylate, it is essential to use personal p...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...