Compound Q&A

What precautions should be taken when handling 4-Bromobenzylsulfonyl chloride (CAS: 53531-69-4)?

Answer

4-Bromobenzylsulfonyl chloride
Proper handling of 4-Bromobenzylsulfonyl chloride requires personal protective equipment (PPE) such as gloves, goggles, and a lab coat. This compound should be stored in a fume hood to minimize exposure to air and moisture. Accidental spills should be handled with caution; immediate decontamination and proper disposal according to safety data sheet (SDS) guidelines are necessary.

About

CAS No 53531-69-4
English Name 4-Bromobenzylsulfonyl chloride
Molecular Formula C7H6BrClO2S
Molecular Weight 269.55 g/mol
SMILES C1=CC(=CC=C1CS(=O)(=O)Cl)Br
InChIKey ZWVWFWGJZPHCHF-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Bromobenzylsulfonyl chloride (CAS: 53531-69-4)?

4-Bromobenzylsulfonyl chloride is a white crystalline solid with a molecular weight of approximately...

Compound Q&A

How is 4-Bromobenzylsulfonyl chloride (CAS: 53531-69-4) typically synthesized?

4-Bromobenzylsulfonyl chloride is typically synthesized from 4-bromobenzylamine and sulfur trioxide....

Compound Q&A

What industries use 4-Bromobenzylsulfonyl chloride (CAS: 53531-69-4)?

4-Bromobenzylsulfonyl chloride is used in various industries, including pharmaceuticals, where it se...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...