Compound Q&A

What are the physical and chemical properties of 4-Bromobenzylsulfonyl chloride (CAS: 53531-69-4)?

Answer

4-Bromobenzylsulfonyl chloride
4-Bromobenzylsulfonyl chloride is a white crystalline solid with a molecular weight of approximately 273.03 g/mol. It is practically insoluble in water but soluble in organic solvents such as ethanol and acetone. This compound is highly reactive due to the presence of the sulfonyl chloride group, making it prone to nucleophilic substitution reactions.

About

CAS No 53531-69-4
English Name 4-Bromobenzylsulfonyl chloride
Molecular Formula C7H6BrClO2S
Molecular Weight 269.55 g/mol
SMILES C1=CC(=CC=C1CS(=O)(=O)Cl)Br
InChIKey ZWVWFWGJZPHCHF-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

How is 4-Bromobenzylsulfonyl chloride (CAS: 53531-69-4) typically synthesized?

4-Bromobenzylsulfonyl chloride is typically synthesized from 4-bromobenzylamine and sulfur trioxide....

Compound Q&A

What industries use 4-Bromobenzylsulfonyl chloride (CAS: 53531-69-4)?

4-Bromobenzylsulfonyl chloride is used in various industries, including pharmaceuticals, where it se...

Compound Q&A

What precautions should be taken when handling 4-Bromobenzylsulfonyl chloride (CAS: 53531-69-4)?

Proper handling of 4-Bromobenzylsulfonyl chloride requires personal protective equipment (PPE) such ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...