Compound Q&A

How is 4-Bromobenzylsulfonyl chloride (CAS: 53531-69-4) typically synthesized?

Answer

4-Bromobenzylsulfonyl chloride
4-Bromobenzylsulfonyl chloride is typically synthesized from 4-bromobenzylamine and sulfur trioxide. The reaction proceeds through the formation of an intermediate sulfinic acid, followed by the addition of chlorinating agents such as thionyl chloride to generate the sulfonyl chloride. The reaction is conducted under anhydrous conditions to prevent hydrolysis.

About

CAS No 53531-69-4
English Name 4-Bromobenzylsulfonyl chloride
Molecular Formula C7H6BrClO2S
Molecular Weight 269.55 g/mol
SMILES C1=CC(=CC=C1CS(=O)(=O)Cl)Br
InChIKey ZWVWFWGJZPHCHF-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-Bromobenzylsulfonyl chloride (CAS: 53531-69-4)?

4-Bromobenzylsulfonyl chloride is a white crystalline solid with a molecular weight of approximately...

Compound Q&A

What industries use 4-Bromobenzylsulfonyl chloride (CAS: 53531-69-4)?

4-Bromobenzylsulfonyl chloride is used in various industries, including pharmaceuticals, where it se...

Compound Q&A

What precautions should be taken when handling 4-Bromobenzylsulfonyl chloride (CAS: 53531-69-4)?

Proper handling of 4-Bromobenzylsulfonyl chloride requires personal protective equipment (PPE) such ...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...