Compound Q&A

What industries use 5'-O-DMT-2'-O-iBu-N-Bz-Guanosine (CAS: 81279-39-2)?

Answer

5'-O-DMT-2'-O-iBu-N-Bz-Guanosine
5'-O-DMT-2'-O-iBu-N-Bz-Guanosine finds application in multiple industries, particularly in pharmaceuticals, where it serves as a fluorescence probe and for the development of therapeutic agents. It is also used in polymer science for functionalizing materials and in biosensors for detecting nucleic acids.

About

CAS No 81279-39-2
English Name 5'-O-DMT-2'-O-iBu-N-Bz-Guanosine
Molecular Formula C41H51N5O8Si
Molecular Weight 769.97 g/mol
SMILES CC(C)C(NC(N1)=NC2=C(N=CN2[C@@H]3O[C@H](COC(C4=CC=C(OC)C=C4)(C5=CC=C(OC)C=C5)C6=CC=CC=C6)[C@@H](O)[C@H]3O[Si](C)(C(C)(C)C)C)C1=O)=O
InChIKey JMCNKJFOIJGYRG-CJEGOSRCSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5'-O-DMT-2'-O-iBu-N-Bz-Guanosine (CAS: 81279-39-2)?

5'-O-DMT-2'-O-iBu-N-Bz-Guanosine is a crystalline compound with a molecular weight of approximately ...

Compound Q&A

How is 5'-O-DMT-2'-O-iBu-N-Bz-Guanosine (CAS: 81279-39-2) typically synthesized?

5'-O-DMT-2'-O-iBu-N-Bz-Guanosine is typically synthesized through a multi-step process involving cou...

Compound Q&A

What precautions should be taken when handling 5'-O-DMT-2'-O-iBu-N-Bz-Guanosine (CAS: 81279-39-2)?

When handling 5'-O-DMT-2'-O-iBu-N-Bz-Guanosine, it is essential to use appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...