Compound Q&A

How is 5'-O-DMT-2'-O-iBu-N-Bz-Guanosine (CAS: 81279-39-2) typically synthesized?

Answer

5'-O-DMT-2'-O-iBu-N-Bz-Guanosine
5'-O-DMT-2'-O-iBu-N-Bz-Guanosine is typically synthesized through a multi-step process involving coupling of guanosine with DMT (N,N'-Diisopropylcarbodiimide) and Boc (tert-butoxycarbonyl) protecting groups. The synthesis involves protecting the hydroxyl groups and then installing the desired functionalities, followed by deprotection to obtain the final product. This process requires careful selection of reagents and conditions to achieve high yield and selectivity.

About

CAS No 81279-39-2
English Name 5'-O-DMT-2'-O-iBu-N-Bz-Guanosine
Molecular Formula C41H51N5O8Si
Molecular Weight 769.97 g/mol
SMILES CC(C)C(NC(N1)=NC2=C(N=CN2[C@@H]3O[C@H](COC(C4=CC=C(OC)C=C4)(C5=CC=C(OC)C=C5)C6=CC=CC=C6)[C@@H](O)[C@H]3O[Si](C)(C(C)(C)C)C)C1=O)=O
InChIKey JMCNKJFOIJGYRG-CJEGOSRCSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 5'-O-DMT-2'-O-iBu-N-Bz-Guanosine (CAS: 81279-39-2)?

5'-O-DMT-2'-O-iBu-N-Bz-Guanosine is a crystalline compound with a molecular weight of approximately ...

Compound Q&A

What industries use 5'-O-DMT-2'-O-iBu-N-Bz-Guanosine (CAS: 81279-39-2)?

5'-O-DMT-2'-O-iBu-N-Bz-Guanosine finds application in multiple industries, particularly in pharmaceu...

Compound Q&A

What precautions should be taken when handling 5'-O-DMT-2'-O-iBu-N-Bz-Guanosine (CAS: 81279-39-2)?

When handling 5'-O-DMT-2'-O-iBu-N-Bz-Guanosine, it is essential to use appropriate personal protecti...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...