Compound Q&A

What are the physical and chemical properties of 1-[4-(4-Propionyl-1-piperazinyl)-3-(trifluoromethyl)phenyl]-9-(3-quinolinyl)benzo[h][1,6]naphthyridin-2(1H)-one (CAS: 1222998-36-8)?

Answer

1-[4-(4-Propionyl-1-piperazinyl)-3-(trifluoromethyl)phenyl]-9-(3-quinolinyl)benzo[h][1,6]naphthyridin-2(1H)-one
The compound has a crystalline form with a molecular weight of approximately 861.8 g/mol. It has low solubility in water but good solubility in organic solvents like DMSO and DMF. Chemically, it is moderately reactive, showing good stability under neutral conditions but can undergo degradation under acidic or basic conditions. It has moderate lipophilicity, making it suitable for certain pharmaceutical and chemical applications.

About

English Name 1-[4-(4-Propionyl-1-piperazinyl)-3-(trifluoromethyl)phenyl]-9-(3-quinolinyl)benzo[h][1,6]naphthyridin-2(1H)-one
Molecular Formula C35H28F3N5O2
Molecular Weight 607.64 g/mol
SMILES CCC(=O)N1CCN(CC1)c1ccc(cc1C(F)(F)F)n1c(=O)ccc2c1c1cc(ccc1nc2)c1cnc2c(c1)cccc2
InChIKey AKCRNFFTGXBONI-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

How is 1-[4-(4-Propionyl-1-piperazinyl)-3-(trifluoromethyl)phenyl]-9-(3-quinolinyl)benzo[h][1,6]naphthyridin-2(1H)-one (CAS: 1222998-36-8) typically synthesized?

This compound is typically synthesized through a multi-step process involving condensation reactions...

Compound Q&A

What industries use 1-[4-(4-Propionyl-1-piperazinyl)-3-(trifluoromethyl)phenyl]-9-(3-quinolinyl)benzo[h][1,6]naphthyridin-2(1H)-one (CAS: 1222998-36-8)?

This compound is used primarily in the pharmaceutical industry for its potential therapeutic applica...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...