Compound Q&A

What industries use (3R)-Tetrahydro-3-furanamine 4-methylbenzenesulfonate (CAS: 111769-27-8)?

Answer

(3R)-Tetrahydro-3-furanamine 4-methylbenzenesulfonate (1:1)
(3R)-Tetrahydro-3-furanamine 4-methylbenzenesulfonate (CAS: 111769-27-8) is used in the pharmaceutical industry for its potential as a precursor in the synthesis of various bioactive compounds. It also finds applications in the development of sensors and semiconductors due to its chemical properties. In polymer science, it can be used in the modification of polymers to improve their functionality.

About

English Name (3R)-Tetrahydro-3-furanamine 4-methylbenzenesulfonate (1:1)
Molecular Formula C11H17NO4S
Molecular Weight 259.33 g/mol
SMILES CC1=CC=C(C=C1)S(=O)(=O)O.C1COCC1N
InChIKey BZXPLADBSZWDIH-FZSMXKCYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of (3R)-Tetrahydro-3-furanamine 4-methylbenzenesulfonate (CAS: 111769-27-8)?

(3R)-Tetrahydro-3-furanamine 4-methylbenzenesulfonate (CAS: 111769-27-8) is a solid compound with a ...

Compound Q&A

How is (3R)-Tetrahydro-3-furanamine 4-methylbenzenesulfonate (CAS: 111769-27-8) typically synthesized?

(3R)-Tetrahydro-3-furanamine 4-methylbenzenesulfonate is typically synthesized by reacting 4-methylb...

Compound Q&A

What precautions should be taken when handling (3R)-Tetrahydro-3-furanamine 4-methylbenzenesulfonate (CAS: 111769-27-8)?

When handling (3R)-Tetrahydro-3-furanamine 4-methylbenzenesulfonate (CAS: 111769-27-8), it is essent...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...