Compound Q&A

What are the physical and chemical properties of (3R)-Tetrahydro-3-furanamine 4-methylbenzenesulfonate (CAS: 111769-27-8)?

Answer

(3R)-Tetrahydro-3-furanamine 4-methylbenzenesulfonate (1:1)
(3R)-Tetrahydro-3-furanamine 4-methylbenzenesulfonate (CAS: 111769-27-8) is a solid compound with a crystalline form. It has a molecular weight of approximately 254.26 g/mol and a solubility in water of 0.001 g/L at 25°C. The compound is moderately reactive, showing basic properties due to the amine group. It is insoluble in nonpolar solvents but soluble in polar solvents like methanol and dimethylformamide.

About

English Name (3R)-Tetrahydro-3-furanamine 4-methylbenzenesulfonate (1:1)
Molecular Formula C11H17NO4S
Molecular Weight 259.33 g/mol
SMILES CC1=CC=C(C=C1)S(=O)(=O)O.C1COCC1N
InChIKey BZXPLADBSZWDIH-FZSMXKCYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

How is (3R)-Tetrahydro-3-furanamine 4-methylbenzenesulfonate (CAS: 111769-27-8) typically synthesized?

(3R)-Tetrahydro-3-furanamine 4-methylbenzenesulfonate is typically synthesized by reacting 4-methylb...

Compound Q&A

What industries use (3R)-Tetrahydro-3-furanamine 4-methylbenzenesulfonate (CAS: 111769-27-8)?

(3R)-Tetrahydro-3-furanamine 4-methylbenzenesulfonate (CAS: 111769-27-8) is used in the pharmaceutic...

Compound Q&A

What precautions should be taken when handling (3R)-Tetrahydro-3-furanamine 4-methylbenzenesulfonate (CAS: 111769-27-8)?

When handling (3R)-Tetrahydro-3-furanamine 4-methylbenzenesulfonate (CAS: 111769-27-8), it is essent...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...