Compound Q&A

What industries use 1,4-Diamino-9,10-dioxo-9,10-dihydro-2,3-anthracenedicarbonitrile (CAS: 81-41-4)?

Answer

1,4-Diamino-9,10-dioxo-9,10-dihydro-2,3-anthracenedicarbonitrile
1,4-Diamino-9,10-dioxo-9,10-dihydro-2,3-anthracenedicarbonitrile (CAS: 81-41-4) is used in the pharmaceutical industry for the synthesis of certain medicinal compounds. It is also utilized in the production of electronic materials, particularly in the development of organic semiconductors and organic light-emitting diodes (OLEDs). Additionally, it has potential applications in the production of advanced polymers and sensors.

About

CAS No 81-41-4
English Name 1,4-Diamino-9,10-dioxo-9,10-dihydro-2,3-anthracenedicarbonitrile
Molecular Formula C16H8N4O2
Molecular Weight 288.26 g/mol
SMILES C1=CC=C2C(=C1)C(=O)C3=C(C(=C(C(=C3C2=O)N)C#N)C#N)N
InChIKey QUZJFTXRXJQLBH-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,4-Diamino-9,10-dioxo-9,10-dihydro-2,3-anthracenedicarbonitrile (CAS: 81-41-4)?

1,4-Diamino-9,10-dioxo-9,10-dihydro-2,3-anthracenedicarbonitrile (CAS: 81-41-4) is a crystalline sol...

Compound Q&A

How is 1,4-Diamino-9,10-dioxo-9,10-dihydro-2,3-anthracenedicarbonitrile (CAS: 81-41-4) typically synthesized?

1,4-Diamino-9,10-dioxo-9,10-dihydro-2,3-anthracenedicarbonitrile (CAS: 81-41-4) is typically synthes...

Compound Q&A

What precautions should be taken when handling 1,4-Diamino-9,10-dioxo-9,10-dihydro-2,3-anthracenedicarbonitrile (CAS: 81-41-4)?

When handling 1,4-Diamino-9,10-dioxo-9,10-dihydro-2,3-anthracenedicarbonitrile (CAS: 81-41-4), it is...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...