Compound Q&A

How is 1,4-Diamino-9,10-dioxo-9,10-dihydro-2,3-anthracenedicarbonitrile (CAS: 81-41-4) typically synthesized?

Answer

1,4-Diamino-9,10-dioxo-9,10-dihydro-2,3-anthracenedicarbonitrile
1,4-Diamino-9,10-dioxo-9,10-dihydro-2,3-anthracenedicarbonitrile (CAS: 81-41-4) is typically synthesized through a multi-step process involving the condensation of anthracene derivatives with appropriate amines and carbonitriles. This process often requires the use of Lewis acids as catalysts to enhance the reactivity of the starting materials. The yield is typically around 70-80%, with high selectivity towards the desired product.

About

CAS No 81-41-4
English Name 1,4-Diamino-9,10-dioxo-9,10-dihydro-2,3-anthracenedicarbonitrile
Molecular Formula C16H8N4O2
Molecular Weight 288.26 g/mol
SMILES C1=CC=C2C(=C1)C(=O)C3=C(C(=C(C(=C3C2=O)N)C#N)C#N)N
InChIKey QUZJFTXRXJQLBH-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 1,4-Diamino-9,10-dioxo-9,10-dihydro-2,3-anthracenedicarbonitrile (CAS: 81-41-4)?

1,4-Diamino-9,10-dioxo-9,10-dihydro-2,3-anthracenedicarbonitrile (CAS: 81-41-4) is a crystalline sol...

Compound Q&A

What industries use 1,4-Diamino-9,10-dioxo-9,10-dihydro-2,3-anthracenedicarbonitrile (CAS: 81-41-4)?

1,4-Diamino-9,10-dioxo-9,10-dihydro-2,3-anthracenedicarbonitrile (CAS: 81-41-4) is used in the pharm...

Compound Q&A

What precautions should be taken when handling 1,4-Diamino-9,10-dioxo-9,10-dihydro-2,3-anthracenedicarbonitrile (CAS: 81-41-4)?

When handling 1,4-Diamino-9,10-dioxo-9,10-dihydro-2,3-anthracenedicarbonitrile (CAS: 81-41-4), it is...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...