Compound Q&A

What are the physical and chemical properties of 1,4-Diamino-9,10-dioxo-9,10-dihydro-2,3-anthracenedicarbonitrile (CAS: 81-41-4)?

Answer

1,4-Diamino-9,10-dioxo-9,10-dihydro-2,3-anthracenedicarbonitrile
1,4-Diamino-9,10-dioxo-9,10-dihydro-2,3-anthracenedicarbonitrile (CAS: 81-41-4) is a crystalline solid with a molecular weight of approximately 346.07 g/mol. It is poorly soluble in water but soluble in polar organic solvents like dimethylformamide. Chemically, it is mildly reactive with basic compounds and exhibits good stability under normal atmospheric conditions. It is not flammable and has a low vapor pressure.

About

CAS No 81-41-4
English Name 1,4-Diamino-9,10-dioxo-9,10-dihydro-2,3-anthracenedicarbonitrile
Molecular Formula C16H8N4O2
Molecular Weight 288.26 g/mol
SMILES C1=CC=C2C(=C1)C(=O)C3=C(C(=C(C(=C3C2=O)N)C#N)C#N)N
InChIKey QUZJFTXRXJQLBH-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

How is 1,4-Diamino-9,10-dioxo-9,10-dihydro-2,3-anthracenedicarbonitrile (CAS: 81-41-4) typically synthesized?

1,4-Diamino-9,10-dioxo-9,10-dihydro-2,3-anthracenedicarbonitrile (CAS: 81-41-4) is typically synthes...

Compound Q&A

What industries use 1,4-Diamino-9,10-dioxo-9,10-dihydro-2,3-anthracenedicarbonitrile (CAS: 81-41-4)?

1,4-Diamino-9,10-dioxo-9,10-dihydro-2,3-anthracenedicarbonitrile (CAS: 81-41-4) is used in the pharm...

Compound Q&A

What precautions should be taken when handling 1,4-Diamino-9,10-dioxo-9,10-dihydro-2,3-anthracenedicarbonitrile (CAS: 81-41-4)?

When handling 1,4-Diamino-9,10-dioxo-9,10-dihydro-2,3-anthracenedicarbonitrile (CAS: 81-41-4), it is...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...