Compound Q&A

How is 4-amino-5-chloro-N-[2-(diethylamino)ethyl]-2-methoxybenzamide hydrochloride (CAS: 7232-21-5) typically synthesized?

Answer

4-amino-5-chloro-N-[2-(diethylamino)ethyl]-2-methoxybenzamide hydrochloride
4-Amino-5-chloro-N-[2-(diethylamino)ethyl]-2-methoxybenzamide hydrochloride is typically synthesized via a multistep process involving the reaction of 5-chloro-2-methoxybenzoic acid with diethylamine, followed by the coupling of the resulting amide with 4-aminobenzamide. The overall reaction involves the use of coupling reagents such as HATU or EDC, and the use of a base like diisopropylethylamine. The yield and selectivity are typically high, with purification achieved through recrystallization from aqueous media.

About

CAS No 7232-21-5
English Name 4-amino-5-chloro-N-[2-(diethylamino)ethyl]-2-methoxybenzamide hydrochloride
Molecular Formula C14H23Cl2N3O2
Molecular Weight 336.26 g/mol
SMILES CCN(CC)CCNC(=O)C1=CC(=C(C=C1OC)N)Cl.Cl
InChIKey RVFUNJWWXKCWNS-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

What are the physical and chemical properties of 4-amino-5-chloro-N-[2-(diethylamino)ethyl]-2-methoxybenzamide hydrochloride (CAS: 7232-21-5)?

4-Amino-5-chloro-N-[2-(diethylamino)ethyl]-2-methoxybenzamide hydrochloride is a crystalline compoun...

Compound Q&A

What industries use 4-amino-5-chloro-N-[2-(diethylamino)ethyl]-2-methoxybenzamide hydrochloride (CAS: 7232-21-5)?

4-Amino-5-chloro-N-[2-(diethylamino)ethyl]-2-methoxybenzamide hydrochloride is primarily used in the...

Compound Q&A

What precautions should be taken when handling 4-amino-5-chloro-N-[2-(diethylamino)ethyl]-2-methoxybenzamide hydrochloride (CAS: 7232-21-5)?

When handling 4-amino-5-chloro-N-[2-(diethylamino)ethyl]-2-methoxybenzamide hydrochloride, it is imp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...