Compound Q&A

What are the physical and chemical properties of 4-amino-5-chloro-N-[2-(diethylamino)ethyl]-2-methoxybenzamide hydrochloride (CAS: 7232-21-5)?

Answer

4-amino-5-chloro-N-[2-(diethylamino)ethyl]-2-methoxybenzamide hydrochloride
4-Amino-5-chloro-N-[2-(diethylamino)ethyl]-2-methoxybenzamide hydrochloride is a crystalline compound with a molecular weight of approximately 413.88 g/mol. It has a solubility of about 14.7 mg/mL in water and is stable to hydrolysis in the absence of strong acids or bases. Reactivity is limited to nucleophilic substitution and electrophilic aromatic substitution. This compound is not flammable and has a low risk of reactivity under normal conditions.

About

CAS No 7232-21-5
English Name 4-amino-5-chloro-N-[2-(diethylamino)ethyl]-2-methoxybenzamide hydrochloride
Molecular Formula C14H23Cl2N3O2
Molecular Weight 336.26 g/mol
SMILES CCN(CC)CCNC(=O)C1=CC(=C(C=C1OC)N)Cl.Cl
InChIKey RVFUNJWWXKCWNS-UHFFFAOYSA-N
Last Updated: 2025-10-20 00:35

Related Q&A

Compound Q&A

How is 4-amino-5-chloro-N-[2-(diethylamino)ethyl]-2-methoxybenzamide hydrochloride (CAS: 7232-21-5) typically synthesized?

4-Amino-5-chloro-N-[2-(diethylamino)ethyl]-2-methoxybenzamide hydrochloride is typically synthesized...

Compound Q&A

What industries use 4-amino-5-chloro-N-[2-(diethylamino)ethyl]-2-methoxybenzamide hydrochloride (CAS: 7232-21-5)?

4-Amino-5-chloro-N-[2-(diethylamino)ethyl]-2-methoxybenzamide hydrochloride is primarily used in the...

Compound Q&A

What precautions should be taken when handling 4-amino-5-chloro-N-[2-(diethylamino)ethyl]-2-methoxybenzamide hydrochloride (CAS: 7232-21-5)?

When handling 4-amino-5-chloro-N-[2-(diethylamino)ethyl]-2-methoxybenzamide hydrochloride, it is imp...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...