Compound Q&A

What industries use 3-(Bromoacetyl)-5-chloro-2-thiophenesulfonamide (CAS: 160982-11-6)?

Answer

3-(Bromoacetyl)-5-chloro-2-thiophenesulfonamide
3-(Bromoacetyl)-5-chloro-2-thiophenesulfonamide is primarily used in the pharmaceutical industry for the synthesis of certain drugs, particularly those targeting metabolic pathways. It also finds applications in the development of novel sensors and semiconductors due to its unique chemical properties. Additionally, it may be used in the polymer industry for specific functionalization and modification of polymers.

About

English Name 3-(Bromoacetyl)-5-chloro-2-thiophenesulfonamide
Molecular Formula C6H5BrClNO3S2
Molecular Weight 318.6 g/mol
SMILES C1=C(SC(=C1C(=O)CBr)S(=O)(=O)N)Cl
InChIKey OZESFFKYLOCAOV-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

What are the physical and chemical properties of 3-(Bromoacetyl)-5-chloro-2-thiophenesulfonamide (CAS: 160982-11-6)?

3-(Bromoacetyl)-5-chloro-2-thiophenesulfonamide is a white to off-white crystalline solid with a mol...

Compound Q&A

How is 3-(Bromoacetyl)-5-chloro-2-thiophenesulfonamide (CAS: 160982-11-6) typically synthesized?

3-(Bromoacetyl)-5-chloro-2-thiophenesulfonamide can be synthesized through a multi-step reaction inv...

Compound Q&A

What precautions should be taken when handling 3-(Bromoacetyl)-5-chloro-2-thiophenesulfonamide (CAS: 160982-11-6)?

When handling 3-(Bromoacetyl)-5-chloro-2-thiophenesulfonamide, it is crucial to wear appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...