Compound Q&A

What are the physical and chemical properties of 3-(Bromoacetyl)-5-chloro-2-thiophenesulfonamide (CAS: 160982-11-6)?

Answer

3-(Bromoacetyl)-5-chloro-2-thiophenesulfonamide
3-(Bromoacetyl)-5-chloro-2-thiophenesulfonamide is a white to off-white crystalline solid with a molecular weight of approximately 350.04 g/mol. It is sparingly soluble in water and readily soluble in organic solvents like ethanol and acetone. The compound is reactive, showing electrophilic aromatic substitution chemistry and nucleophilic substitution at the bromoacetyl and thiophene rings. It is stable under normal conditions but should be stored in a dry environment away from moisture and light.

About

English Name 3-(Bromoacetyl)-5-chloro-2-thiophenesulfonamide
Molecular Formula C6H5BrClNO3S2
Molecular Weight 318.6 g/mol
SMILES C1=C(SC(=C1C(=O)CBr)S(=O)(=O)N)Cl
InChIKey OZESFFKYLOCAOV-UHFFFAOYSA-N
Last Updated: 2025-10-19 20:30

Related Q&A

Compound Q&A

How is 3-(Bromoacetyl)-5-chloro-2-thiophenesulfonamide (CAS: 160982-11-6) typically synthesized?

3-(Bromoacetyl)-5-chloro-2-thiophenesulfonamide can be synthesized through a multi-step reaction inv...

Compound Q&A

What industries use 3-(Bromoacetyl)-5-chloro-2-thiophenesulfonamide (CAS: 160982-11-6)?

3-(Bromoacetyl)-5-chloro-2-thiophenesulfonamide is primarily used in the pharmaceutical industry for...

Compound Q&A

What precautions should be taken when handling 3-(Bromoacetyl)-5-chloro-2-thiophenesulfonamide (CAS: 160982-11-6)?

When handling 3-(Bromoacetyl)-5-chloro-2-thiophenesulfonamide, it is crucial to wear appropriate per...

Compound Q&A

What is 6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one (CAS: 21889-89-4)?

6-Methyl-7-oxabicyclo[4.1.0]heptan-2-one is a cyclic ketone with a molecular for...

21889-89-46-Methyl-7-oxabicycl...
Compound Q&A

What is 4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid (CAS: 906353-00-2)?

4-[(6-Methyl-2-pyrazinyl)oxy]benzoic acid is a chemical compound with the CAS nu...

906353-00-24-[(6-Methyl-2-pyraz...
Compound Q&A

What is 2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8)?

2-(2-Pyridinyl)-1,3-propanediol (CAS: 49745-42-8) is a colorless to slightly yel...

49745-42-82-(2-Pyridinyl)-1,3-...
Compound Q&A

What is 2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile (CAS: 24783-42-4)?

2-(6-Chloro-2-pyridinyl)-2-phenylacetonitrile is an organic compound with the CA...

24783-42-42-(6-Chloro-2-pyridi...